About 7-nitro-1,3-dihydroindol-2-one
7-nitro-1,3-dihydroindol-2-one (PubChem CID 6424838) has the molecular formula C8H6N2O3
and a molecular weight of 178.15 g/mol. Its IUPAC name is 7-nitro-1,3-dihydroindol-2-one.
Molecular Properties
| Compound Name | 7-nitro-1,3-dihydroindol-2-one |
| PubChem CID | 6424838 |
| Molecular Formula | C8H6N2O3 |
| Molecular Weight | 178.15 g/mol |
| Exact Mass | 178.04 |
| IUPAC Name | 7-nitro-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2cccc([N+](=O)[O-])c2N1 |
| InChI | InChI=1S/C8H6N2O3/c11-7-4-5-2-1-3-6(10(12)13)8(5)9-7/h1-3H,4H2,(H,9,11) |
| InChIKey | VGANBSWHOYEFKJ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.15 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-nitro-1,3-dihydroindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-nitro-1,3-dihydroindol-2-one?
The IUPAC name of 7-nitro-1,3-dihydroindol-2-one (CID 6424838) is 7-nitro-1,3-dihydroindol-2-one.
What is the SMILES notation for 7-nitro-1,3-dihydroindol-2-one?
The canonical SMILES for 7-nitro-1,3-dihydroindol-2-one is O=C1Cc2cccc([N+](=O)[O-])c2N1.
What is the InChIKey of 7-nitro-1,3-dihydroindol-2-one?
The InChIKey is VGANBSWHOYEFKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O3/c11-7-4-5-2-1-3-6(10(12)13)8(5)9-7/h1-3H,4H2,(H,9,11).
What are the key properties of 7-nitro-1,3-dihydroindol-2-one?
7-nitro-1,3-dihydroindol-2-one has a molecular weight of 178.15 g/mol, XLogP of 1.09, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-nitro-1,3-dihydroindol-2-one is sourced from PubChem (CID 6424838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).