C26H52N2O2 — CID 6424911
N,N,N',N'-tetrahexyloxamide (PubChem CID 6424911) has the molecular formula C26H52N2O2 and a molecular weight of 424.71 g/mol. Its IUPAC name is N,N,N',N'-tetrahexyloxamide.
| Compound Name | N,N,N',N'-tetrahexyloxamide |
|---|---|
| PubChem CID | 6424911 |
| Molecular Formula | C26H52N2O2 |
| Molecular Weight | 424.71 g/mol |
| Exact Mass | 424.40 |
| IUPAC Name | N,N,N',N'-tetrahexyloxamide |
| SMILES | CCCCCCN(CCCCCC)C(=O)C(=O)N(CCCCCC)CCCCCC |
| InChI | InChI=1S/C26H52N2O2/c1-5-9-13-17-21-27(22-18-14-10-6-2)25(29)26(30)28(23-19-15-11-7-3)24-20-16-12-8-4/h5-24H2,1-4H3 |
| InChIKey | IBCLPRPRYAHGPE-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.71 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|