C13H2F9NO — CID 6425086
(4-amino-2,3,5,6-tetrafluorophenyl)-(2,3,4,5,6-pentafluorophenyl)methanone (PubChem CID 6425086) has the molecular formula C13H2F9NO and a molecular weight of 359.15 g/mol. Its IUPAC name is (4-amino-2,3,5,6-tetrafluorophenyl)-(2,3,4,5,6-pentafluorophenyl)methanone.
| Compound Name | (4-amino-2,3,5,6-tetrafluorophenyl)-(2,3,4,5,6-pentafluorophenyl)methanone |
|---|---|
| PubChem CID | 6425086 |
| Molecular Formula | C13H2F9NO |
| Molecular Weight | 359.15 g/mol |
| Exact Mass | 359.00 |
| IUPAC Name | (4-amino-2,3,5,6-tetrafluorophenyl)-(2,3,4,5,6-pentafluorophenyl)methanone |
| SMILES | Nc1c(F)c(F)c(C(=O)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C13H2F9NO/c14-3-1(4(15)8(19)9(20)7(3)18)13(24)2-5(16)10(21)12(23)11(22)6(2)17/h23H2 |
| InChIKey | OQIGDWDOJQWYBO-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.15 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|