C11H18Cl3NO4 — CID 6425234
4-methylpentyl 2-(2,2,2-trichloroethoxycarbonylamino)acetate (PubChem CID 6425234) has the molecular formula C11H18Cl3NO4 and a molecular weight of 334.63 g/mol. Its IUPAC name is 4-methylpentyl 2-(2,2,2-trichloroethoxycarbonylamino)acetate.
| Compound Name | 4-methylpentyl 2-(2,2,2-trichloroethoxycarbonylamino)acetate |
|---|---|
| PubChem CID | 6425234 |
| Molecular Formula | C11H18Cl3NO4 |
| Molecular Weight | 334.63 g/mol |
| Exact Mass | 333.03 |
| IUPAC Name | 4-methylpentyl 2-(2,2,2-trichloroethoxycarbonylamino)acetate |
| SMILES | CC(C)CCCOC(=O)CNC(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H18Cl3NO4/c1-8(2)4-3-5-18-9(16)6-15-10(17)19-7-11(12,13)14/h8H,3-7H2,1-2H3,(H,15,17) |
| InChIKey | AAOUAMGPOLDANO-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.63 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|