About 3-Chloro-1,1,3,3-tetraisopropyldisiloxane
3-Chloro-1,1,3,3-tetraisopropyldisiloxane (PubChem CID 6425667) has the molecular formula C12H28ClOSi2
and a molecular weight of 279.98 g/mol.
Molecular Properties
| Compound Name | 3-Chloro-1,1,3,3-tetraisopropyldisiloxane |
| PubChem CID | 6425667 |
| Molecular Formula | C12H28ClOSi2 |
| Molecular Weight | 279.98 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | — |
| SMILES | CC(C)[Si](O[Si](Cl)(C(C)C)C(C)C)C(C)C |
| InChI | InChI=1S/C12H28ClOSi2/c1-9(2)15(10(3)4)14-16(13,11(5)6)12(7)8/h9-12H,1-8H3 |
| InChIKey | WDGGBFZFNLHLMP-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 279.98 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze 3-Chloro-1,1,3,3-tetraisopropyldisiloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-Chloro-1,1,3,3-tetraisopropyldisiloxane?
The IUPAC name of 3-Chloro-1,1,3,3-tetraisopropyldisiloxane (CID 6425667) is not available.
What is the SMILES notation for 3-Chloro-1,1,3,3-tetraisopropyldisiloxane?
The canonical SMILES for 3-Chloro-1,1,3,3-tetraisopropyldisiloxane is CC(C)[Si](O[Si](Cl)(C(C)C)C(C)C)C(C)C.
What is the InChIKey of 3-Chloro-1,1,3,3-tetraisopropyldisiloxane?
The InChIKey is WDGGBFZFNLHLMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H28ClOSi2/c1-9(2)15(10(3)4)14-16(13,11(5)6)12(7)8/h9-12H,1-8H3.
What are the key properties of 3-Chloro-1,1,3,3-tetraisopropyldisiloxane?
3-Chloro-1,1,3,3-tetraisopropyldisiloxane has a molecular weight of 279.98 g/mol, XLogP of 5.32, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-Chloro-1,1,3,3-tetraisopropyldisiloxane is sourced from PubChem (CID 6425667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).