About 2-methoxy-3,5-dimethyl-6-(4-oxooxolan-2-yl)pyran-4-one
2-methoxy-3,5-dimethyl-6-(4-oxooxolan-2-yl)pyran-4-one (PubChem CID 6425676) has the molecular formula C12H14O5
and a molecular weight of 238.24 g/mol. Its IUPAC name is 2-methoxy-3,5-dimethyl-6-(4-oxooxolan-2-yl)pyran-4-one.
Molecular Properties
| Compound Name | 2-methoxy-3,5-dimethyl-6-(4-oxooxolan-2-yl)pyran-4-one |
| PubChem CID | 6425676 |
| Molecular Formula | C12H14O5 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 2-methoxy-3,5-dimethyl-6-(4-oxooxolan-2-yl)pyran-4-one |
| SMILES | COc1oc(C2CC(=O)CO2)c(C)c(=O)c1C |
| InChI | InChI=1S/C12H14O5/c1-6-10(14)7(2)12(15-3)17-11(6)9-4-8(13)5-16-9/h9H,4-5H2,1-3H3 |
| InChIKey | WBALLCJOFSKUDR-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-methoxy-3,5-dimethyl-6-(4-oxooxolan-2-yl)pyran-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-3,5-dimethyl-6-(4-oxooxolan-2-yl)pyran-4-one?
The IUPAC name of 2-methoxy-3,5-dimethyl-6-(4-oxooxolan-2-yl)pyran-4-one (CID 6425676) is 2-methoxy-3,5-dimethyl-6-(4-oxooxolan-2-yl)pyran-4-one.
What is the SMILES notation for 2-methoxy-3,5-dimethyl-6-(4-oxooxolan-2-yl)pyran-4-one?
The canonical SMILES for 2-methoxy-3,5-dimethyl-6-(4-oxooxolan-2-yl)pyran-4-one is COc1oc(C2CC(=O)CO2)c(C)c(=O)c1C.
What is the InChIKey of 2-methoxy-3,5-dimethyl-6-(4-oxooxolan-2-yl)pyran-4-one?
The InChIKey is WBALLCJOFSKUDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O5/c1-6-10(14)7(2)12(15-3)17-11(6)9-4-8(13)5-16-9/h9H,4-5H2,1-3H3.
What are the key properties of 2-methoxy-3,5-dimethyl-6-(4-oxooxolan-2-yl)pyran-4-one?
2-methoxy-3,5-dimethyl-6-(4-oxooxolan-2-yl)pyran-4-one has a molecular weight of 238.24 g/mol, XLogP of 1.30, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-3,5-dimethyl-6-(4-oxooxolan-2-yl)pyran-4-one is sourced from PubChem (CID 6425676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).