C18H26F7NO3 — CID 6425711
undec-10-enyl 2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)propanoate (PubChem CID 6425711) has the molecular formula C18H26F7NO3 and a molecular weight of 437.40 g/mol. Its IUPAC name is undec-10-enyl 2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)propanoate.
| Compound Name | undec-10-enyl 2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)propanoate |
|---|---|
| PubChem CID | 6425711 |
| Molecular Formula | C18H26F7NO3 |
| Molecular Weight | 437.40 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | undec-10-enyl 2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)propanoate |
| SMILES | C=CCCCCCCCCCOC(=O)C(C)NC(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C18H26F7NO3/c1-3-4-5-6-7-8-9-10-11-12-29-14(27)13(2)26-15(28)16(19,20)17(21,22)18(23,24)25/h3,13H,1,4-12H2,2H3,(H,26,28) |
| InChIKey | ALTBZBCQRUWCIA-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.40 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|