About 1-ethyl-3,3-dimethylspiro[indole-2,5'-pyrrolidine]-2'-one
1-ethyl-3,3-dimethylspiro[indole-2,5'-pyrrolidine]-2'-one (PubChem CID 6425748) has the molecular formula C15H20N2O
and a molecular weight of 244.34 g/mol. Its IUPAC name is 1-ethyl-3,3-dimethylspiro[indole-2,5'-pyrrolidine]-2'-one.
Molecular Properties
| Compound Name | 1-ethyl-3,3-dimethylspiro[indole-2,5'-pyrrolidine]-2'-one |
| PubChem CID | 6425748 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | 1-ethyl-3,3-dimethylspiro[indole-2,5'-pyrrolidine]-2'-one |
| SMILES | CCN1c2ccccc2C(C)(C)C12CCC(=O)N2 |
| InChI | InChI=1S/C15H20N2O/c1-4-17-12-8-6-5-7-11(12)14(2,3)15(17)10-9-13(18)16-15/h5-8H,4,9-10H2,1-3H3,(H,16,18) |
| InChIKey | LUPVTXAILOSQAM-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-ethyl-3,3-dimethylspiro[indole-2,5'-pyrrolidine]-2'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3,3-dimethylspiro[indole-2,5'-pyrrolidine]-2'-one?
The IUPAC name of 1-ethyl-3,3-dimethylspiro[indole-2,5'-pyrrolidine]-2'-one (CID 6425748) is 1-ethyl-3,3-dimethylspiro[indole-2,5'-pyrrolidine]-2'-one.
What is the SMILES notation for 1-ethyl-3,3-dimethylspiro[indole-2,5'-pyrrolidine]-2'-one?
The canonical SMILES for 1-ethyl-3,3-dimethylspiro[indole-2,5'-pyrrolidine]-2'-one is CCN1c2ccccc2C(C)(C)C12CCC(=O)N2.
What is the InChIKey of 1-ethyl-3,3-dimethylspiro[indole-2,5'-pyrrolidine]-2'-one?
The InChIKey is LUPVTXAILOSQAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2O/c1-4-17-12-8-6-5-7-11(12)14(2,3)15(17)10-9-13(18)16-15/h5-8H,4,9-10H2,1-3H3,(H,16,18).
What are the key properties of 1-ethyl-3,3-dimethylspiro[indole-2,5'-pyrrolidine]-2'-one?
1-ethyl-3,3-dimethylspiro[indole-2,5'-pyrrolidine]-2'-one has a molecular weight of 244.34 g/mol, XLogP of 2.41, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3,3-dimethylspiro[indole-2,5'-pyrrolidine]-2'-one is sourced from PubChem (CID 6425748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).