About 1-phenyldibenzofuran
1-phenyldibenzofuran (PubChem CID 6425749) has the molecular formula C18H12O
and a molecular weight of 244.29 g/mol. Its IUPAC name is 1-phenyldibenzofuran.
Molecular Properties
| Compound Name | 1-phenyldibenzofuran |
| PubChem CID | 6425749 |
| Molecular Formula | C18H12O |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | 1-phenyldibenzofuran |
| SMILES | c1ccc(-c2cccc3oc4ccccc4c23)cc1 |
| InChI | InChI=1S/C18H12O/c1-2-7-13(8-3-1)14-10-6-12-17-18(14)15-9-4-5-11-16(15)19-17/h1-12H |
| InChIKey | PABWCQBWXPHCBX-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-phenyldibenzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyldibenzofuran?
The IUPAC name of 1-phenyldibenzofuran (CID 6425749) is 1-phenyldibenzofuran.
What is the SMILES notation for 1-phenyldibenzofuran?
The canonical SMILES for 1-phenyldibenzofuran is c1ccc(-c2cccc3oc4ccccc4c23)cc1.
What is the InChIKey of 1-phenyldibenzofuran?
The InChIKey is PABWCQBWXPHCBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12O/c1-2-7-13(8-3-1)14-10-6-12-17-18(14)15-9-4-5-11-16(15)19-17/h1-12H.
What are the key properties of 1-phenyldibenzofuran?
1-phenyldibenzofuran has a molecular weight of 244.29 g/mol, XLogP of 5.25, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyldibenzofuran is sourced from PubChem (CID 6425749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).