About 4,5-diphenylpyran-2-one
4,5-diphenylpyran-2-one (PubChem CID 6425792) has the molecular formula C17H12O2
and a molecular weight of 248.28 g/mol. Its IUPAC name is 4,5-diphenylpyran-2-one.
Molecular Properties
| Compound Name | 4,5-diphenylpyran-2-one |
| PubChem CID | 6425792 |
| Molecular Formula | C17H12O2 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 4,5-diphenylpyran-2-one |
| SMILES | O=c1cc(-c2ccccc2)c(-c2ccccc2)co1 |
| InChI | InChI=1S/C17H12O2/c18-17-11-15(13-7-3-1-4-8-13)16(12-19-17)14-9-5-2-6-10-14/h1-12H |
| InChIKey | PRHJRLIQXXJXKZ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,5-diphenylpyran-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-diphenylpyran-2-one?
The IUPAC name of 4,5-diphenylpyran-2-one (CID 6425792) is 4,5-diphenylpyran-2-one.
What is the SMILES notation for 4,5-diphenylpyran-2-one?
The canonical SMILES for 4,5-diphenylpyran-2-one is O=c1cc(-c2ccccc2)c(-c2ccccc2)co1.
What is the InChIKey of 4,5-diphenylpyran-2-one?
The InChIKey is PRHJRLIQXXJXKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12O2/c18-17-11-15(13-7-3-1-4-8-13)16(12-19-17)14-9-5-2-6-10-14/h1-12H.
What are the key properties of 4,5-diphenylpyran-2-one?
4,5-diphenylpyran-2-one has a molecular weight of 248.28 g/mol, XLogP of 3.97, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-diphenylpyran-2-one is sourced from PubChem (CID 6425792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).