About ethynyl(triphenyl)silane
ethynyl(triphenyl)silane (PubChem CID 642601) has the molecular formula C20H16Si
and a molecular weight of 284.43 g/mol. Its IUPAC name is ethynyl(triphenyl)silane.
Molecular Properties
| Compound Name | ethynyl(triphenyl)silane |
| PubChem CID | 642601 |
| Molecular Formula | C20H16Si |
| Molecular Weight | 284.43 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | ethynyl(triphenyl)silane |
| SMILES | C#C[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H16Si/c1-2-21(18-12-6-3-7-13-18,19-14-8-4-9-15-19)20-16-10-5-11-17-20/h1,3-17H |
| InChIKey | WADKYPSVXRWORK-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.43 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze ethynyl(triphenyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethynyl(triphenyl)silane?
The IUPAC name of ethynyl(triphenyl)silane (CID 642601) is ethynyl(triphenyl)silane.
What is the SMILES notation for ethynyl(triphenyl)silane?
The canonical SMILES for ethynyl(triphenyl)silane is C#C[Si](c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of ethynyl(triphenyl)silane?
The InChIKey is WADKYPSVXRWORK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16Si/c1-2-21(18-12-6-3-7-13-18,19-14-8-4-9-15-19)20-16-10-5-11-17-20/h1,3-17H.
What are the key properties of ethynyl(triphenyl)silane?
ethynyl(triphenyl)silane has a molecular weight of 284.43 g/mol, XLogP of 2.33, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethynyl(triphenyl)silane is sourced from PubChem (CID 642601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).