C26H19F5N2O4 — CID 6426095
(2,3,4,5,6-pentafluorophenyl) 3-(1,3-dioxo-6-piperidin-1-ylbenzo[de]isoquinolin-2-yl)propanoate (PubChem CID 6426095) has the molecular formula C26H19F5N2O4 and a molecular weight of 518.44 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 3-(1,3-dioxo-6-piperidin-1-ylbenzo[de]isoquinolin-2-yl)propanoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 3-(1,3-dioxo-6-piperidin-1-ylbenzo[de]isoquinolin-2-yl)propanoate |
|---|---|
| PubChem CID | 6426095 |
| Molecular Formula | C26H19F5N2O4 |
| Molecular Weight | 518.44 g/mol |
| Exact Mass | 518.13 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 3-(1,3-dioxo-6-piperidin-1-ylbenzo[de]isoquinolin-2-yl)propanoate |
| SMILES | O=C(CCN1C(=O)c2cccc3c(N4CCCCC4)ccc(c23)C1=O)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C26H19F5N2O4/c27-19-20(28)22(30)24(23(31)21(19)29)37-17(34)9-12-33-25(35)14-6-4-5-13-16(32-10-2-1-3-11-32)8-7-15(18(13)14)26(33)36/h4-8H,1-3,9-12H2 |
| InChIKey | DPQGETUBPNEZCD-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.44 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|