About triphenoxy(phenyl)silane
triphenoxy(phenyl)silane (PubChem CID 6426512) has the molecular formula C24H20O3Si
and a molecular weight of 384.51 g/mol. Its IUPAC name is triphenoxy(phenyl)silane.
Molecular Properties
| Compound Name | triphenoxy(phenyl)silane |
| PubChem CID | 6426512 |
| Molecular Formula | C24H20O3Si |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | triphenoxy(phenyl)silane |
| SMILES | c1ccc(O[Si](Oc2ccccc2)(Oc2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H20O3Si/c1-5-13-21(14-6-1)25-28(24-19-11-4-12-20-24,26-22-15-7-2-8-16-22)27-23-17-9-3-10-18-23/h1-20H |
| InChIKey | IXJNGXCZSCHDFE-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze triphenoxy(phenyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triphenoxy(phenyl)silane?
The IUPAC name of triphenoxy(phenyl)silane (CID 6426512) is triphenoxy(phenyl)silane.
What is the SMILES notation for triphenoxy(phenyl)silane?
The canonical SMILES for triphenoxy(phenyl)silane is c1ccc(O[Si](Oc2ccccc2)(Oc2ccccc2)c2ccccc2)cc1.
What is the InChIKey of triphenoxy(phenyl)silane?
The InChIKey is IXJNGXCZSCHDFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20O3Si/c1-5-13-21(14-6-1)25-28(24-19-11-4-12-20-24,26-22-15-7-2-8-16-22)27-23-17-9-3-10-18-23/h1-20H.
What are the key properties of triphenoxy(phenyl)silane?
triphenoxy(phenyl)silane has a molecular weight of 384.51 g/mol, XLogP of 5.07, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for triphenoxy(phenyl)silane is sourced from PubChem (CID 6426512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).