C10H9F2N3O — CID 6426669
1-(2,4-difluorophenyl)-2-(1,2,4-triazol-1-yl)ethanol (PubChem CID 6426669) has the molecular formula C10H9F2N3O and a molecular weight of 225.20 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-2-(1,2,4-triazol-1-yl)ethanol.
| Compound Name | 1-(2,4-difluorophenyl)-2-(1,2,4-triazol-1-yl)ethanol |
|---|---|
| PubChem CID | 6426669 |
| Molecular Formula | C10H9F2N3O |
| Molecular Weight | 225.20 g/mol |
| Exact Mass | 225.07 |
| IUPAC Name | 1-(2,4-difluorophenyl)-2-(1,2,4-triazol-1-yl)ethanol |
| SMILES | OC(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C10H9F2N3O/c11-7-1-2-8(9(12)3-7)10(16)4-15-6-13-5-14-15/h1-3,5-6,10,16H,4H2 |
| InChIKey | NQNSXRYFTHGTTO-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.20 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |