C8H16 — CID 6427077
cis-(1S,3R)-1,2,3-trimethylcyclopentane (PubChem CID 6427077) has the molecular formula C8H16 and a molecular weight of 112.22 g/mol. Its IUPAC name is cis-(1S,3R)-1,2,3-trimethylcyclopentane.
| Compound Name | cis-(1S,3R)-1,2,3-trimethylcyclopentane |
|---|---|
| PubChem CID | 6427077 |
| Molecular Formula | C8H16 |
| Molecular Weight | 112.22 g/mol |
| Exact Mass | 112.13 |
| IUPAC Name | cis-(1S,3R)-1,2,3-trimethylcyclopentane |
| SMILES | CC1[C@H](C)CC[C@@H]1C |
| InChI | InChI=1S/C8H16/c1-6-4-5-7(2)8(6)3/h6-8H,4-5H2,1-3H3/t6-,7+,8? |
| InChIKey | VCWNHOPGKQCXIQ-DHBOJHSNSA-N |
| XLogP | 2.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 112.22 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |