About trans-(1R,2R)-1,2-dimethylcyclopropane
trans-(1R,2R)-1,2-dimethylcyclopropane (PubChem CID 6427079) has the molecular formula C5H10
and a molecular weight of 70.13 g/mol. Its IUPAC name is trans-(1R,2R)-1,2-dimethylcyclopropane.
Molecular Properties
| Compound Name | trans-(1R,2R)-1,2-dimethylcyclopropane |
| PubChem CID | 6427079 |
| Molecular Formula | C5H10 |
| Molecular Weight | 70.13 g/mol |
| Exact Mass | 70.08 |
| IUPAC Name | trans-(1R,2R)-1,2-dimethylcyclopropane |
| SMILES | C[C@@H]1C[C@H]1C |
| InChI | InChI=1S/C5H10/c1-4-3-5(4)2/h4-5H,3H2,1-2H3/t4-,5-/m1/s1 |
| InChIKey | VKJLDXGFBJBTRQ-RFZPGFLSSA-N |
| XLogP | 1.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 70.13 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze trans-(1R,2R)-1,2-dimethylcyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1R,2R)-1,2-dimethylcyclopropane?
The IUPAC name of trans-(1R,2R)-1,2-dimethylcyclopropane (CID 6427079) is trans-(1R,2R)-1,2-dimethylcyclopropane.
What is the SMILES notation for trans-(1R,2R)-1,2-dimethylcyclopropane?
The canonical SMILES for trans-(1R,2R)-1,2-dimethylcyclopropane is C[C@@H]1C[C@H]1C.
What is the InChIKey of trans-(1R,2R)-1,2-dimethylcyclopropane?
The InChIKey is VKJLDXGFBJBTRQ-RFZPGFLSSA-N. The full InChI is InChI=1S/C5H10/c1-4-3-5(4)2/h4-5H,3H2,1-2H3/t4-,5-/m1/s1.
What are the key properties of trans-(1R,2R)-1,2-dimethylcyclopropane?
trans-(1R,2R)-1,2-dimethylcyclopropane has a molecular weight of 70.13 g/mol, XLogP of 1.66, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1R,2R)-1,2-dimethylcyclopropane is sourced from PubChem (CID 6427079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).