C13H11BO2 — CID 6427225
(6bR,9aS)-8-methyl-6b,9a-dihydroacenaphthyleno[1,2-d][1,3,2]dioxaborole (PubChem CID 6427225) has the molecular formula C13H11BO2 and a molecular weight of 210.04 g/mol. Its IUPAC name is (6bR,9aS)-8-methyl-6b,9a-dihydroacenaphthyleno[1,2-d][1,3,2]dioxaborole.
| Compound Name | (6bR,9aS)-8-methyl-6b,9a-dihydroacenaphthyleno[1,2-d][1,3,2]dioxaborole |
|---|---|
| PubChem CID | 6427225 |
| Molecular Formula | C13H11BO2 |
| Molecular Weight | 210.04 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | (6bR,9aS)-8-methyl-6b,9a-dihydroacenaphthyleno[1,2-d][1,3,2]dioxaborole |
| SMILES | CB1O[C@@H]2c3cccc4cccc(c34)[C@@H]2O1 |
| InChI | InChI=1S/C13H11BO2/c1-14-15-12-9-6-2-4-8-5-3-7-10(11(8)9)13(12)16-14/h2-7,12-13H,1H3/t12-,13+ |
| InChIKey | CNGWVNBPEOSVSZ-BETUJISGSA-N |
| XLogP | 3.10 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.04 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|