C18H19BO2 — CID 6427237
(3aS,11bR)-2-butyl-3a,11b-dihydrophenanthro[9,10-d][1,3,2]dioxaborole (PubChem CID 6427237) has the molecular formula C18H19BO2 and a molecular weight of 278.16 g/mol. Its IUPAC name is (3aS,11bR)-2-butyl-3a,11b-dihydrophenanthro[9,10-d][1,3,2]dioxaborole.
| Compound Name | (3aS,11bR)-2-butyl-3a,11b-dihydrophenanthro[9,10-d][1,3,2]dioxaborole |
|---|---|
| PubChem CID | 6427237 |
| Molecular Formula | C18H19BO2 |
| Molecular Weight | 278.16 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | (3aS,11bR)-2-butyl-3a,11b-dihydrophenanthro[9,10-d][1,3,2]dioxaborole |
| SMILES | CCCCB1O[C@@H]2c3ccccc3-c3ccccc3[C@@H]2O1 |
| InChI | InChI=1S/C18H19BO2/c1-2-3-12-19-20-17-15-10-6-4-8-13(15)14-9-5-7-11-16(14)18(17)21-19/h4-11,17-18H,2-3,12H2,1H3/t17-,18+ |
| InChIKey | ZTXNKDBFIHNYIO-HDICACEKSA-N |
| XLogP | 4.78 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.16 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|