C15H13BO2 — CID 6427239
(3aR,11bS)-2-methyl-3a,11b-dihydrophenanthro[9,10-d][1,3,2]dioxaborole (PubChem CID 6427239) has the molecular formula C15H13BO2 and a molecular weight of 236.08 g/mol. Its IUPAC name is (3aR,11bS)-2-methyl-3a,11b-dihydrophenanthro[9,10-d][1,3,2]dioxaborole.
| Compound Name | (3aR,11bS)-2-methyl-3a,11b-dihydrophenanthro[9,10-d][1,3,2]dioxaborole |
|---|---|
| PubChem CID | 6427239 |
| Molecular Formula | C15H13BO2 |
| Molecular Weight | 236.08 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | (3aR,11bS)-2-methyl-3a,11b-dihydrophenanthro[9,10-d][1,3,2]dioxaborole |
| SMILES | CB1O[C@@H]2c3ccccc3-c3ccccc3[C@@H]2O1 |
| InChI | InChI=1S/C15H13BO2/c1-16-17-14-12-8-4-2-6-10(12)11-7-3-5-9-13(11)15(14)18-16/h2-9,14-15H,1H3/t14-,15+ |
| InChIKey | YNTJDOULWYMRAF-GASCZTMLSA-N |
| XLogP | 3.61 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.08 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|