C16H15BO2 — CID 6427256
(3aS,11bR)-2,3a-dimethyl-11bH-phenanthro[9,10-d][1,3,2]dioxaborole (PubChem CID 6427256) has the molecular formula C16H15BO2 and a molecular weight of 250.11 g/mol. Its IUPAC name is (3aS,11bR)-2,3a-dimethyl-11bH-phenanthro[9,10-d][1,3,2]dioxaborole.
| Compound Name | (3aS,11bR)-2,3a-dimethyl-11bH-phenanthro[9,10-d][1,3,2]dioxaborole |
|---|---|
| PubChem CID | 6427256 |
| Molecular Formula | C16H15BO2 |
| Molecular Weight | 250.11 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | (3aS,11bR)-2,3a-dimethyl-11bH-phenanthro[9,10-d][1,3,2]dioxaborole |
| SMILES | CB1O[C@@H]2c3ccccc3-c3ccccc3[C@]2(C)O1 |
| InChI | InChI=1S/C16H15BO2/c1-16-14-10-6-5-8-12(14)11-7-3-4-9-13(11)15(16)18-17(2)19-16/h3-10,15H,1-2H3/t15-,16+/m1/s1 |
| InChIKey | SPHLRXJREQHRMK-CVEARBPZSA-N |
| XLogP | 3.79 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.11 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|