C15H15BO2 — CID 6427266
(3aR,11bR)-2-methyl-3a,4,5,11b-tetrahydronaphtho[2,3-e][1,3,2]benzodioxaborole (PubChem CID 6427266) has the molecular formula C15H15BO2 and a molecular weight of 238.10 g/mol. Its IUPAC name is (3aR,11bR)-2-methyl-3a,4,5,11b-tetrahydronaphtho[2,3-e][1,3,2]benzodioxaborole.
| Compound Name | (3aR,11bR)-2-methyl-3a,4,5,11b-tetrahydronaphtho[2,3-e][1,3,2]benzodioxaborole |
|---|---|
| PubChem CID | 6427266 |
| Molecular Formula | C15H15BO2 |
| Molecular Weight | 238.10 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | (3aR,11bR)-2-methyl-3a,4,5,11b-tetrahydronaphtho[2,3-e][1,3,2]benzodioxaborole |
| SMILES | CB1O[C@@H]2c3cc4ccccc4cc3CC[C@H]2O1 |
| InChI | InChI=1S/C15H15BO2/c1-16-17-14-7-6-12-8-10-4-2-3-5-11(10)9-13(12)15(14)18-16/h2-5,8-9,14-15H,6-7H2,1H3/t14-,15-/m1/s1 |
| InChIKey | NJQMHEASOUJRTC-HUUCEWRRSA-N |
| XLogP | 3.36 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.10 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|