C18H28O2Si — CID 6427383
(3aR,9aR)-2,2-ditert-butyl-3a,4,9,9a-tetrahydrobenzo[f][1,3,2]benzodioxasilole (PubChem CID 6427383) has the molecular formula C18H28O2Si and a molecular weight of 304.51 g/mol. Its IUPAC name is (3aR,9aR)-2,2-ditert-butyl-3a,4,9,9a-tetrahydrobenzo[f][1,3,2]benzodioxasilole.
| Compound Name | (3aR,9aR)-2,2-ditert-butyl-3a,4,9,9a-tetrahydrobenzo[f][1,3,2]benzodioxasilole |
|---|---|
| PubChem CID | 6427383 |
| Molecular Formula | C18H28O2Si |
| Molecular Weight | 304.51 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | (3aR,9aR)-2,2-ditert-butyl-3a,4,9,9a-tetrahydrobenzo[f][1,3,2]benzodioxasilole |
| SMILES | CC(C)(C)[Si]1(C(C)(C)C)O[C@@H]2Cc3ccccc3C[C@H]2O1 |
| InChI | InChI=1S/C18H28O2Si/c1-17(2,3)21(18(4,5)6)19-15-11-13-9-7-8-10-14(13)12-16(15)20-21/h7-10,15-16H,11-12H2,1-6H3/t15-,16-/m1/s1 |
| InChIKey | ZGGDUGVGAUHMTA-HZPDHXFCSA-N |
| XLogP | 4.61 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.51 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|