About cis-(2R,3S)-1-methyl-2,3-bis(methylsulfanyl)-4-propan-2-ylcyclohexane
cis-(2R,3S)-1-methyl-2,3-bis(methylsulfanyl)-4-propan-2-ylcyclohexane (PubChem CID 6427462) has the molecular formula C12H24S2
and a molecular weight of 232.46 g/mol. Its IUPAC name is cis-(2R,3S)-1-methyl-2,3-bis(methylsulfanyl)-4-propan-2-ylcyclohexane.
Molecular Properties
| Compound Name | cis-(2R,3S)-1-methyl-2,3-bis(methylsulfanyl)-4-propan-2-ylcyclohexane |
| PubChem CID | 6427462 |
| Molecular Formula | C12H24S2 |
| Molecular Weight | 232.46 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | cis-(2R,3S)-1-methyl-2,3-bis(methylsulfanyl)-4-propan-2-ylcyclohexane |
| SMILES | CS[C@@H]1C(C)CCC(C(C)C)[C@@H]1SC |
| InChI | InChI=1S/C12H24S2/c1-8(2)10-7-6-9(3)11(13-4)12(10)14-5/h8-12H,6-7H2,1-5H3/t9?,10?,11-,12+/m1/s1 |
| InChIKey | WYXMBTZBVVOMRW-HCWSGVFWSA-N |
| XLogP | 4.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.46 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cis-(2R,3S)-1-methyl-2,3-bis(methylsulfanyl)-4-propan-2-ylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(2R,3S)-1-methyl-2,3-bis(methylsulfanyl)-4-propan-2-ylcyclohexane?
The IUPAC name of cis-(2R,3S)-1-methyl-2,3-bis(methylsulfanyl)-4-propan-2-ylcyclohexane (CID 6427462) is cis-(2R,3S)-1-methyl-2,3-bis(methylsulfanyl)-4-propan-2-ylcyclohexane.
What is the SMILES notation for cis-(2R,3S)-1-methyl-2,3-bis(methylsulfanyl)-4-propan-2-ylcyclohexane?
The canonical SMILES for cis-(2R,3S)-1-methyl-2,3-bis(methylsulfanyl)-4-propan-2-ylcyclohexane is CS[C@@H]1C(C)CCC(C(C)C)[C@@H]1SC.
What is the InChIKey of cis-(2R,3S)-1-methyl-2,3-bis(methylsulfanyl)-4-propan-2-ylcyclohexane?
The InChIKey is WYXMBTZBVVOMRW-HCWSGVFWSA-N. The full InChI is InChI=1S/C12H24S2/c1-8(2)10-7-6-9(3)11(13-4)12(10)14-5/h8-12H,6-7H2,1-5H3/t9?,10?,11-,12+/m1/s1.
What are the key properties of cis-(2R,3S)-1-methyl-2,3-bis(methylsulfanyl)-4-propan-2-ylcyclohexane?
cis-(2R,3S)-1-methyl-2,3-bis(methylsulfanyl)-4-propan-2-ylcyclohexane has a molecular weight of 232.46 g/mol, XLogP of 4.15, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(2R,3S)-1-methyl-2,3-bis(methylsulfanyl)-4-propan-2-ylcyclohexane is sourced from PubChem (CID 6427462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).