About (6R)-6-phenyl-1,4-oxathian-2-one
(6R)-6-phenyl-1,4-oxathian-2-one (PubChem CID 642756) has the molecular formula C10H10O2S
and a molecular weight of 194.26 g/mol. Its IUPAC name is (6R)-6-phenyl-1,4-oxathian-2-one.
Molecular Properties
| Compound Name | (6R)-6-phenyl-1,4-oxathian-2-one |
| PubChem CID | 642756 |
| Molecular Formula | C10H10O2S |
| Molecular Weight | 194.26 g/mol |
| Exact Mass | 194.04 |
| IUPAC Name | (6R)-6-phenyl-1,4-oxathian-2-one |
| SMILES | O=C1CSC[C@@H](c2ccccc2)O1 |
| InChI | InChI=1S/C10H10O2S/c11-10-7-13-6-9(12-10)8-4-2-1-3-5-8/h1-5,9H,6-7H2/t9-/m0/s1 |
| InChIKey | SPYHJJYHOOPZBK-VIFPVBQESA-N |
| XLogP | 2.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.26 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (6R)-6-phenyl-1,4-oxathian-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R)-6-phenyl-1,4-oxathian-2-one?
The IUPAC name of (6R)-6-phenyl-1,4-oxathian-2-one (CID 642756) is (6R)-6-phenyl-1,4-oxathian-2-one.
What is the SMILES notation for (6R)-6-phenyl-1,4-oxathian-2-one?
The canonical SMILES for (6R)-6-phenyl-1,4-oxathian-2-one is O=C1CSC[C@@H](c2ccccc2)O1.
What is the InChIKey of (6R)-6-phenyl-1,4-oxathian-2-one?
The InChIKey is SPYHJJYHOOPZBK-VIFPVBQESA-N. The full InChI is InChI=1S/C10H10O2S/c11-10-7-13-6-9(12-10)8-4-2-1-3-5-8/h1-5,9H,6-7H2/t9-/m0/s1.
What are the key properties of (6R)-6-phenyl-1,4-oxathian-2-one?
(6R)-6-phenyl-1,4-oxathian-2-one has a molecular weight of 194.26 g/mol, XLogP of 2.02, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6R)-6-phenyl-1,4-oxathian-2-one is sourced from PubChem (CID 642756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).