About (3R,6R)-3-methyl-6-phenyl-1,4-oxathian-2-one
(3R,6R)-3-methyl-6-phenyl-1,4-oxathian-2-one (PubChem CID 642777) has the molecular formula C11H12O2S
and a molecular weight of 208.28 g/mol. Its IUPAC name is (3R,6R)-3-methyl-6-phenyl-1,4-oxathian-2-one.
Molecular Properties
| Compound Name | (3R,6R)-3-methyl-6-phenyl-1,4-oxathian-2-one |
| PubChem CID | 642777 |
| Molecular Formula | C11H12O2S |
| Molecular Weight | 208.28 g/mol |
| Exact Mass | 208.06 |
| IUPAC Name | (3R,6R)-3-methyl-6-phenyl-1,4-oxathian-2-one |
| SMILES | C[C@H]1SC[C@@H](c2ccccc2)OC1=O |
| InChI | InChI=1S/C11H12O2S/c1-8-11(12)13-10(7-14-8)9-5-3-2-4-6-9/h2-6,8,10H,7H2,1H3/t8-,10+/m1/s1 |
| InChIKey | BNBLVOYPHKPBTG-SCZZXKLOSA-N |
| XLogP | 2.41 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.28 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3R,6R)-3-methyl-6-phenyl-1,4-oxathian-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,6R)-3-methyl-6-phenyl-1,4-oxathian-2-one?
The IUPAC name of (3R,6R)-3-methyl-6-phenyl-1,4-oxathian-2-one (CID 642777) is (3R,6R)-3-methyl-6-phenyl-1,4-oxathian-2-one.
What is the SMILES notation for (3R,6R)-3-methyl-6-phenyl-1,4-oxathian-2-one?
The canonical SMILES for (3R,6R)-3-methyl-6-phenyl-1,4-oxathian-2-one is C[C@H]1SC[C@@H](c2ccccc2)OC1=O.
What is the InChIKey of (3R,6R)-3-methyl-6-phenyl-1,4-oxathian-2-one?
The InChIKey is BNBLVOYPHKPBTG-SCZZXKLOSA-N. The full InChI is InChI=1S/C11H12O2S/c1-8-11(12)13-10(7-14-8)9-5-3-2-4-6-9/h2-6,8,10H,7H2,1H3/t8-,10+/m1/s1.
What are the key properties of (3R,6R)-3-methyl-6-phenyl-1,4-oxathian-2-one?
(3R,6R)-3-methyl-6-phenyl-1,4-oxathian-2-one has a molecular weight of 208.28 g/mol, XLogP of 2.41, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,6R)-3-methyl-6-phenyl-1,4-oxathian-2-one is sourced from PubChem (CID 642777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).