About 9-butyl-9H-fluorene
9-butyl-9H-fluorene (PubChem CID 6427878) has the molecular formula C17H18
and a molecular weight of 222.33 g/mol. Its IUPAC name is 9-butyl-9H-fluorene.
Molecular Properties
| Compound Name | 9-butyl-9H-fluorene |
| PubChem CID | 6427878 |
| Molecular Formula | C17H18 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 9-butyl-9H-fluorene |
| SMILES | CCCCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C17H18/c1-2-3-8-13-14-9-4-6-11-16(14)17-12-7-5-10-15(13)17/h4-7,9-13H,2-3,8H2,1H3 |
| InChIKey | RBDADLSAYYPJAN-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 9-butyl-9H-fluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-butyl-9H-fluorene?
The IUPAC name of 9-butyl-9H-fluorene (CID 6427878) is 9-butyl-9H-fluorene.
What is the SMILES notation for 9-butyl-9H-fluorene?
The canonical SMILES for 9-butyl-9H-fluorene is CCCCC1c2ccccc2-c2ccccc21.
What is the InChIKey of 9-butyl-9H-fluorene?
The InChIKey is RBDADLSAYYPJAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18/c1-2-3-8-13-14-9-4-6-11-16(14)17-12-7-5-10-15(13)17/h4-7,9-13H,2-3,8H2,1H3.
What are the key properties of 9-butyl-9H-fluorene?
9-butyl-9H-fluorene has a molecular weight of 222.33 g/mol, XLogP of 4.99, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 9-butyl-9H-fluorene is sourced from PubChem (CID 6427878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).