C17H42O5Si4 — CID 6427897
trimethyl-[(2R,3S,5R)-2,3,5-tris(trimethylsilyloxy)oxan-4-yl]oxysilane (PubChem CID 6427897) has the molecular formula C17H42O5Si4 and a molecular weight of 438.86 g/mol. Its IUPAC name is trimethyl-[(2R,3S,5R)-2,3,5-tris(trimethylsilyloxy)oxan-4-yl]oxysilane.
| Compound Name | trimethyl-[(2R,3S,5R)-2,3,5-tris(trimethylsilyloxy)oxan-4-yl]oxysilane |
|---|---|
| PubChem CID | 6427897 |
| Molecular Formula | C17H42O5Si4 |
| Molecular Weight | 438.86 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | trimethyl-[(2R,3S,5R)-2,3,5-tris(trimethylsilyloxy)oxan-4-yl]oxysilane |
| SMILES | C[Si](C)(C)OC1[C@H](O[Si](C)(C)C)CO[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C17H42O5Si4/c1-23(2,3)19-14-13-18-17(22-26(10,11)12)16(21-25(7,8)9)15(14)20-24(4,5)6/h14-17H,13H2,1-12H3/t14-,15?,16+,17-/m1/s1 |
| InChIKey | KEOUSSOURMHEKN-KFIMKLJYSA-N |
| XLogP | 4.85 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.86 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|