About 1,7-dibromodibenzofuran
1,7-dibromodibenzofuran (PubChem CID 6427988) has the molecular formula C12H6Br2O
and a molecular weight of 325.99 g/mol. Its IUPAC name is 1,7-dibromodibenzofuran.
Molecular Properties
| Compound Name | 1,7-dibromodibenzofuran |
| PubChem CID | 6427988 |
| Molecular Formula | C12H6Br2O |
| Molecular Weight | 325.99 g/mol |
| Exact Mass | 323.88 |
| IUPAC Name | 1,7-dibromodibenzofuran |
| SMILES | Brc1ccc2c(c1)oc1cccc(Br)c12 |
| InChI | InChI=1S/C12H6Br2O/c13-7-4-5-8-11(6-7)15-10-3-1-2-9(14)12(8)10/h1-6H |
| InChIKey | HXTPPPWXNHSMLZ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 325.99 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,7-dibromodibenzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,7-dibromodibenzofuran?
The IUPAC name of 1,7-dibromodibenzofuran (CID 6427988) is 1,7-dibromodibenzofuran.
What is the SMILES notation for 1,7-dibromodibenzofuran?
The canonical SMILES for 1,7-dibromodibenzofuran is Brc1ccc2c(c1)oc1cccc(Br)c12.
What is the InChIKey of 1,7-dibromodibenzofuran?
The InChIKey is HXTPPPWXNHSMLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H6Br2O/c13-7-4-5-8-11(6-7)15-10-3-1-2-9(14)12(8)10/h1-6H.
What are the key properties of 1,7-dibromodibenzofuran?
1,7-dibromodibenzofuran has a molecular weight of 325.99 g/mol, XLogP of 5.11, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,7-dibromodibenzofuran is sourced from PubChem (CID 6427988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).