C12H6Br2O — CID 6427988
1,7-dibromodibenzofuran (PubChem CID 6427988) has the molecular formula C12H6Br2O and a molecular weight of 325.99 g/mol. Its IUPAC name is 1,7-dibromodibenzofuran.
| Compound Name | 1,7-dibromodibenzofuran |
|---|---|
| PubChem CID | 6427988 |
| Molecular Formula | C12H6Br2O |
| Molecular Weight | 325.99 g/mol |
| Exact Mass | 323.88 |
| IUPAC Name | 1,7-dibromodibenzofuran |
| SMILES | Brc1ccc2c(c1)oc1cccc(Br)c12 |
| InChI | InChI=1S/C12H6Br2O/c13-7-4-5-8-11(6-7)15-10-3-1-2-9(14)12(8)10/h1-6H |
| InChIKey | HXTPPPWXNHSMLZ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.99 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |