About 4-(4-pyridin-4-ylbuta-1,3-diynyl)pyridine
4-(4-pyridin-4-ylbuta-1,3-diynyl)pyridine (PubChem CID 642802) has the molecular formula C14H8N2
and a molecular weight of 204.23 g/mol. Its IUPAC name is 4-(4-pyridin-4-ylbuta-1,3-diynyl)pyridine.
Molecular Properties
| Compound Name | 4-(4-pyridin-4-ylbuta-1,3-diynyl)pyridine |
| PubChem CID | 642802 |
| Molecular Formula | C14H8N2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | 4-(4-pyridin-4-ylbuta-1,3-diynyl)pyridine |
| SMILES | C(C#Cc1ccncc1)#Cc1ccncc1 |
| InChI | InChI=1S/C14H8N2/c1(3-13-5-9-15-10-6-13)2-4-14-7-11-16-12-8-14/h5-12H |
| InChIKey | BKRBETINLDNENR-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-pyridin-4-ylbuta-1,3-diynyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-pyridin-4-ylbuta-1,3-diynyl)pyridine?
The IUPAC name of 4-(4-pyridin-4-ylbuta-1,3-diynyl)pyridine (CID 642802) is 4-(4-pyridin-4-ylbuta-1,3-diynyl)pyridine.
What is the SMILES notation for 4-(4-pyridin-4-ylbuta-1,3-diynyl)pyridine?
The canonical SMILES for 4-(4-pyridin-4-ylbuta-1,3-diynyl)pyridine is C(C#Cc1ccncc1)#Cc1ccncc1.
What is the InChIKey of 4-(4-pyridin-4-ylbuta-1,3-diynyl)pyridine?
The InChIKey is BKRBETINLDNENR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8N2/c1(3-13-5-9-15-10-6-13)2-4-14-7-11-16-12-8-14/h5-12H.
What are the key properties of 4-(4-pyridin-4-ylbuta-1,3-diynyl)pyridine?
4-(4-pyridin-4-ylbuta-1,3-diynyl)pyridine has a molecular weight of 204.23 g/mol, XLogP of 1.88, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-pyridin-4-ylbuta-1,3-diynyl)pyridine is sourced from PubChem (CID 642802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).