C8H16O4 — CID 6428066
(2R,3S,4S)-3,4-dimethoxy-2-(methoxymethyl)oxolane (PubChem CID 6428066) has the molecular formula C8H16O4 and a molecular weight of 176.21 g/mol. Its IUPAC name is (2R,3S,4S)-3,4-dimethoxy-2-(methoxymethyl)oxolane.
| Compound Name | (2R,3S,4S)-3,4-dimethoxy-2-(methoxymethyl)oxolane |
|---|---|
| PubChem CID | 6428066 |
| Molecular Formula | C8H16O4 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.10 |
| IUPAC Name | (2R,3S,4S)-3,4-dimethoxy-2-(methoxymethyl)oxolane |
| SMILES | COC[C@H]1OC[C@H](OC)[C@@H]1OC |
| InChI | InChI=1S/C8H16O4/c1-9-4-7-8(11-3)6(10-2)5-12-7/h6-8H,4-5H2,1-3H3/t6-,7+,8-/m0/s1 |
| InChIKey | PFPWLRZFWHVNMO-RNJXMRFFSA-N |
| XLogP | 0.06 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |