C28H48O3Si — CID 6428096
methyl (4R)-4-[(3R,10S,13R)-10,13-dimethyl-3-trimethylsilyloxy-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate (PubChem CID 6428096) has the molecular formula C28H48O3Si and a molecular weight of 460.78 g/mol. Its IUPAC name is methyl (4R)-4-[(3R,10S,13R)-10,13-dimethyl-3-trimethylsilyloxy-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate.
| Compound Name | methyl (4R)-4-[(3R,10S,13R)-10,13-dimethyl-3-trimethylsilyloxy-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
|---|---|
| PubChem CID | 6428096 |
| Molecular Formula | C28H48O3Si |
| Molecular Weight | 460.78 g/mol |
| Exact Mass | 460.34 |
| IUPAC Name | methyl (4R)-4-[(3R,10S,13R)-10,13-dimethyl-3-trimethylsilyloxy-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
| SMILES | COC(=O)CC[C@@H](C)C1CCC2C3C=CC4C[C@H](O[Si](C)(C)C)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C28H48O3Si/c1-19(8-13-26(29)30-4)23-11-12-24-22-10-9-20-18-21(31-32(5,6)7)14-16-27(20,2)25(22)15-17-28(23,24)3/h9-10,19-25H,8,11-18H2,1-7H3/t19-,20?,21-,22?,23?,24?,25?,27+,28-/m1/s1 |
| InChIKey | BIPZZLZEQQMIIO-NQBFQEJBSA-N |
| XLogP | 7.23 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.78 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|