C18H8S2 — CID 6428181
9,14-dithiahexacyclo[11.7.0.02,10.03,8.04,19.015,20]icosa-1(13),2(10),3,5,7,11,15,17,19-nonaene (PubChem CID 6428181) has the molecular formula C18H8S2 and a molecular weight of 288.40 g/mol. Its IUPAC name is 9,14-dithiahexacyclo[11.7.0.02,10.03,8.04,19.015,20]icosa-1(13),2(10),3,5,7,11,15,17,19-nonaene.
| Compound Name | 9,14-dithiahexacyclo[11.7.0.02,10.03,8.04,19.015,20]icosa-1(13),2(10),3,5,7,11,15,17,19-nonaene |
|---|---|
| PubChem CID | 6428181 |
| Molecular Formula | C18H8S2 |
| Molecular Weight | 288.40 g/mol |
| Exact Mass | 288.01 |
| IUPAC Name | 9,14-dithiahexacyclo[11.7.0.02,10.03,8.04,19.015,20]icosa-1(13),2(10),3,5,7,11,15,17,19-nonaene |
| SMILES | c1cc2sc3ccc4sc5cccc6c(c1)c2c3c4c56 |
| InChI | InChI=1S/C18H8S2/c1-3-9-10-4-2-6-12-16(10)18-14(20-12)8-7-13-17(18)15(9)11(5-1)19-13/h1-8H |
| InChIKey | FRRKTHIVLIBONP-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.40 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|