C14H20O2 — CID 6428345
1-[(1aS,2aS,3R,7aR)-2a,3-dimethyl-2,3,4,5,7,7a-hexahydronaphtho[2,3-b]oxiren-1a-yl]ethanone (PubChem CID 6428345) has the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. Its IUPAC name is 1-[(1aS,2aS,3R,7aR)-2a,3-dimethyl-2,3,4,5,7,7a-hexahydronaphtho[2,3-b]oxiren-1a-yl]ethanone.
| Compound Name | 1-[(1aS,2aS,3R,7aR)-2a,3-dimethyl-2,3,4,5,7,7a-hexahydronaphtho[2,3-b]oxiren-1a-yl]ethanone |
|---|---|
| PubChem CID | 6428345 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | 1-[(1aS,2aS,3R,7aR)-2a,3-dimethyl-2,3,4,5,7,7a-hexahydronaphtho[2,3-b]oxiren-1a-yl]ethanone |
| SMILES | CC(=O)[C@]12C[C@]3(C)C(=CCC[C@H]3C)C[C@H]1O2 |
| InChI | InChI=1S/C14H20O2/c1-9-5-4-6-11-7-12-14(16-12,10(2)15)8-13(9,11)3/h6,9,12H,4-5,7-8H2,1-3H3/t9-,12-,13+,14-/m1/s1 |
| InChIKey | OQXGSYYUEPULKW-WBMYTEFPSA-N |
| XLogP | 2.87 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|