C15H22O — CID 6428370
2-[(2R,6S,8S)-1,2-dimethyl-8-tetracyclo[4.4.0.02,4.03,7]decanyl]propanal (PubChem CID 6428370) has the molecular formula C15H22O and a molecular weight of 218.34 g/mol. Its IUPAC name is 2-[(2R,6S,8S)-1,2-dimethyl-8-tetracyclo[4.4.0.02,4.03,7]decanyl]propanal.
| Compound Name | 2-[(2R,6S,8S)-1,2-dimethyl-8-tetracyclo[4.4.0.02,4.03,7]decanyl]propanal |
|---|---|
| PubChem CID | 6428370 |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | 2-[(2R,6S,8S)-1,2-dimethyl-8-tetracyclo[4.4.0.02,4.03,7]decanyl]propanal |
| SMILES | CC(C=O)C1CCC2(C)[C@H]3CC4C(C13)[C@@]42C |
| InChI | InChI=1S/C15H22O/c1-8(7-16)9-4-5-14(2)10-6-11-13(12(9)10)15(11,14)3/h7-13H,4-6H2,1-3H3/t8?,9?,10-,11?,12?,13?,14?,15+/m0/s1 |
| InChIKey | JLHUXFWGEBRDST-RJLWODDMSA-N |
| XLogP | 3.14 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|