C17H28F3NO3Si2 — CID 6428502
N-[2-[3,4-bis(trimethylsilyloxy)phenyl]ethyl]-2,2,2-trifluoro-N-methylacetamide (PubChem CID 6428502) has the molecular formula C17H28F3NO3Si2 and a molecular weight of 407.58 g/mol. Its IUPAC name is N-[2-[3,4-bis(trimethylsilyloxy)phenyl]ethyl]-2,2,2-trifluoro-N-methylacetamide.
| Compound Name | N-[2-[3,4-bis(trimethylsilyloxy)phenyl]ethyl]-2,2,2-trifluoro-N-methylacetamide |
|---|---|
| PubChem CID | 6428502 |
| Molecular Formula | C17H28F3NO3Si2 |
| Molecular Weight | 407.58 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | N-[2-[3,4-bis(trimethylsilyloxy)phenyl]ethyl]-2,2,2-trifluoro-N-methylacetamide |
| SMILES | CN(CCc1ccc(O[Si](C)(C)C)c(O[Si](C)(C)C)c1)C(=O)C(F)(F)F |
| InChI | InChI=1S/C17H28F3NO3Si2/c1-21(16(22)17(18,19)20)11-10-13-8-9-14(23-25(2,3)4)15(12-13)24-26(5,6)7/h8-9,12H,10-11H2,1-7H3 |
| InChIKey | SLQQLJGJUQZDSV-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.58 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|