C17H26F3NO4Si2 — CID 6428511
trimethylsilyl 2-[(2,2,2-trifluoroacetyl)amino]-3-(3-trimethylsilyloxyphenyl)propanoate (PubChem CID 6428511) has the molecular formula C17H26F3NO4Si2 and a molecular weight of 421.56 g/mol. Its IUPAC name is trimethylsilyl 2-[(2,2,2-trifluoroacetyl)amino]-3-(3-trimethylsilyloxyphenyl)propanoate.
| Compound Name | trimethylsilyl 2-[(2,2,2-trifluoroacetyl)amino]-3-(3-trimethylsilyloxyphenyl)propanoate |
|---|---|
| PubChem CID | 6428511 |
| Molecular Formula | C17H26F3NO4Si2 |
| Molecular Weight | 421.56 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | trimethylsilyl 2-[(2,2,2-trifluoroacetyl)amino]-3-(3-trimethylsilyloxyphenyl)propanoate |
| SMILES | C[Si](C)(C)OC(=O)C(Cc1cccc(O[Si](C)(C)C)c1)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C17H26F3NO4Si2/c1-26(2,3)24-13-9-7-8-12(10-13)11-14(15(22)25-27(4,5)6)21-16(23)17(18,19)20/h7-10,14H,11H2,1-6H3,(H,21,23) |
| InChIKey | LBWRPLMPFPGNAU-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.56 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|