About methyl (4E,8E)-deca-4,8-dienoate
methyl (4E,8E)-deca-4,8-dienoate (PubChem CID 6428540) has the molecular formula C11H18O2
and a molecular weight of 182.26 g/mol. Its IUPAC name is methyl (4E,8E)-deca-4,8-dienoate.
Molecular Properties
| Compound Name | methyl (4E,8E)-deca-4,8-dienoate |
| PubChem CID | 6428540 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | methyl (4E,8E)-deca-4,8-dienoate |
| SMILES | C/C=C/CC/C=C/CCC(=O)OC |
| InChI | InChI=1S/C11H18O2/c1-3-4-5-6-7-8-9-10-11(12)13-2/h3-4,7-8H,5-6,9-10H2,1-2H3/b4-3+,8-7+ |
| InChIKey | ZYNYTTXGMNCKDP-DYWGDJMRSA-N |
| XLogP | 2.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl (4E,8E)-deca-4,8-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (4E,8E)-deca-4,8-dienoate?
The IUPAC name of methyl (4E,8E)-deca-4,8-dienoate (CID 6428540) is methyl (4E,8E)-deca-4,8-dienoate.
What is the SMILES notation for methyl (4E,8E)-deca-4,8-dienoate?
The canonical SMILES for methyl (4E,8E)-deca-4,8-dienoate is C/C=C/CC/C=C/CCC(=O)OC.
What is the InChIKey of methyl (4E,8E)-deca-4,8-dienoate?
The InChIKey is ZYNYTTXGMNCKDP-DYWGDJMRSA-N. The full InChI is InChI=1S/C11H18O2/c1-3-4-5-6-7-8-9-10-11(12)13-2/h3-4,7-8H,5-6,9-10H2,1-2H3/b4-3+,8-7+.
What are the key properties of methyl (4E,8E)-deca-4,8-dienoate?
methyl (4E,8E)-deca-4,8-dienoate has a molecular weight of 182.26 g/mol, XLogP of 2.85, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (4E,8E)-deca-4,8-dienoate is sourced from PubChem (CID 6428540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).