About 2,5-diethylfuran
2,5-diethylfuran (PubChem CID 6428556) has the molecular formula C8H12O
and a molecular weight of 124.18 g/mol. Its IUPAC name is 2,5-diethylfuran.
Molecular Properties
| Compound Name | 2,5-diethylfuran |
| PubChem CID | 6428556 |
| Molecular Formula | C8H12O |
| Molecular Weight | 124.18 g/mol |
| Exact Mass | 124.09 |
| IUPAC Name | 2,5-diethylfuran |
| SMILES | CCc1ccc(CC)o1 |
| InChI | InChI=1S/C8H12O/c1-3-7-5-6-8(4-2)9-7/h5-6H,3-4H2,1-2H3 |
| InChIKey | OKYQOKFZRFUBJX-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.18 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,5-diethylfuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-diethylfuran?
The IUPAC name of 2,5-diethylfuran (CID 6428556) is 2,5-diethylfuran.
What is the SMILES notation for 2,5-diethylfuran?
The canonical SMILES for 2,5-diethylfuran is CCc1ccc(CC)o1.
What is the InChIKey of 2,5-diethylfuran?
The InChIKey is OKYQOKFZRFUBJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O/c1-3-7-5-6-8(4-2)9-7/h5-6H,3-4H2,1-2H3.
What are the key properties of 2,5-diethylfuran?
2,5-diethylfuran has a molecular weight of 124.18 g/mol, XLogP of 2.40, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-diethylfuran is sourced from PubChem (CID 6428556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).