About 2-phenylpyrazine
2-phenylpyrazine (PubChem CID 642870) has the molecular formula C10H8N2
and a molecular weight of 156.19 g/mol. Its IUPAC name is 2-phenylpyrazine.
Molecular Properties
| Compound Name | 2-phenylpyrazine |
| PubChem CID | 642870 |
| Molecular Formula | C10H8N2 |
| Molecular Weight | 156.19 g/mol |
| Exact Mass | 156.07 |
| IUPAC Name | 2-phenylpyrazine |
| SMILES | c1ccc(-c2cnccn2)cc1 |
| InChI | InChI=1S/C10H8N2/c1-2-4-9(5-3-1)10-8-11-6-7-12-10/h1-8H |
| InChIKey | LNJZJDLDXQQJSG-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.19 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-phenylpyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylpyrazine?
The IUPAC name of 2-phenylpyrazine (CID 642870) is 2-phenylpyrazine.
What is the SMILES notation for 2-phenylpyrazine?
The canonical SMILES for 2-phenylpyrazine is c1ccc(-c2cnccn2)cc1.
What is the InChIKey of 2-phenylpyrazine?
The InChIKey is LNJZJDLDXQQJSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2/c1-2-4-9(5-3-1)10-8-11-6-7-12-10/h1-8H.
What are the key properties of 2-phenylpyrazine?
2-phenylpyrazine has a molecular weight of 156.19 g/mol, XLogP of 2.14, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylpyrazine is sourced from PubChem (CID 642870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).