About (4Z)-3,5,5-trimethyl-4-(3-oxobutylidene)cyclohex-2-en-1-one
(4Z)-3,5,5-trimethyl-4-(3-oxobutylidene)cyclohex-2-en-1-one (PubChem CID 6428786) has the molecular formula C13H18O2
and a molecular weight of 206.28 g/mol. Its IUPAC name is (4Z)-3,5,5-trimethyl-4-(3-oxobutylidene)cyclohex-2-en-1-one.
Molecular Properties
| Compound Name | (4Z)-3,5,5-trimethyl-4-(3-oxobutylidene)cyclohex-2-en-1-one |
| PubChem CID | 6428786 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | (4Z)-3,5,5-trimethyl-4-(3-oxobutylidene)cyclohex-2-en-1-one |
| SMILES | CC(=O)C/C=C1\C(C)=CC(=O)CC1(C)C |
| InChI | InChI=1S/C13H18O2/c1-9-7-11(15)8-13(3,4)12(9)6-5-10(2)14/h6-7H,5,8H2,1-4H3/b12-6+ |
| InChIKey | QATWEJYZQLSRAL-WUXMJOGZSA-N |
| XLogP | 2.84 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4Z)-3,5,5-trimethyl-4-(3-oxobutylidene)cyclohex-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-3,5,5-trimethyl-4-(3-oxobutylidene)cyclohex-2-en-1-one?
The IUPAC name of (4Z)-3,5,5-trimethyl-4-(3-oxobutylidene)cyclohex-2-en-1-one (CID 6428786) is (4Z)-3,5,5-trimethyl-4-(3-oxobutylidene)cyclohex-2-en-1-one.
What is the SMILES notation for (4Z)-3,5,5-trimethyl-4-(3-oxobutylidene)cyclohex-2-en-1-one?
The canonical SMILES for (4Z)-3,5,5-trimethyl-4-(3-oxobutylidene)cyclohex-2-en-1-one is CC(=O)C/C=C1\C(C)=CC(=O)CC1(C)C.
What is the InChIKey of (4Z)-3,5,5-trimethyl-4-(3-oxobutylidene)cyclohex-2-en-1-one?
The InChIKey is QATWEJYZQLSRAL-WUXMJOGZSA-N. The full InChI is InChI=1S/C13H18O2/c1-9-7-11(15)8-13(3,4)12(9)6-5-10(2)14/h6-7H,5,8H2,1-4H3/b12-6+.
What are the key properties of (4Z)-3,5,5-trimethyl-4-(3-oxobutylidene)cyclohex-2-en-1-one?
(4Z)-3,5,5-trimethyl-4-(3-oxobutylidene)cyclohex-2-en-1-one has a molecular weight of 206.28 g/mol, XLogP of 2.84, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-3,5,5-trimethyl-4-(3-oxobutylidene)cyclohex-2-en-1-one is sourced from PubChem (CID 6428786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).