About 2-butyl-5-methylpyrazine
2-butyl-5-methylpyrazine (PubChem CID 6428803) has the molecular formula C9H14N2
and a molecular weight of 150.22 g/mol. Its IUPAC name is 2-butyl-5-methylpyrazine.
Molecular Properties
| Compound Name | 2-butyl-5-methylpyrazine |
| PubChem CID | 6428803 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 2-butyl-5-methylpyrazine |
| SMILES | CCCCc1cnc(C)cn1 |
| InChI | InChI=1S/C9H14N2/c1-3-4-5-9-7-10-8(2)6-11-9/h6-7H,3-5H2,1-2H3 |
| InChIKey | ICMOJSQWNJQRQI-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-butyl-5-methylpyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-5-methylpyrazine?
The IUPAC name of 2-butyl-5-methylpyrazine (CID 6428803) is 2-butyl-5-methylpyrazine.
What is the SMILES notation for 2-butyl-5-methylpyrazine?
The canonical SMILES for 2-butyl-5-methylpyrazine is CCCCc1cnc(C)cn1.
What is the InChIKey of 2-butyl-5-methylpyrazine?
The InChIKey is ICMOJSQWNJQRQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2/c1-3-4-5-9-7-10-8(2)6-11-9/h6-7H,3-5H2,1-2H3.
What are the key properties of 2-butyl-5-methylpyrazine?
2-butyl-5-methylpyrazine has a molecular weight of 150.22 g/mol, XLogP of 2.13, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-5-methylpyrazine is sourced from PubChem (CID 6428803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).