About methyl 7-[(1R,5S)-2-oxo-5-[(E,3R)-3-trimethylsilyloxyoct-1-enyl]cyclopent-3-en-1-yl]heptanoate
methyl 7-[(1R,5S)-2-oxo-5-[(E,3R)-3-trimethylsilyloxyoct-1-enyl]cyclopent-3-en-1-yl]heptanoate (PubChem CID 6428805) has the molecular formula C24H42O4Si
and a molecular weight of 422.68 g/mol. Its IUPAC name is methyl 7-[(1R,5S)-2-oxo-5-[(E,3R)-3-trimethylsilyloxyoct-1-enyl]cyclopent-3-en-1-yl]heptanoate.
Molecular Properties
| Compound Name | methyl 7-[(1R,5S)-2-oxo-5-[(E,3R)-3-trimethylsilyloxyoct-1-enyl]cyclopent-3-en-1-yl]heptanoate |
| PubChem CID | 6428805 |
| Molecular Formula | C24H42O4Si |
| Molecular Weight | 422.68 g/mol |
| Exact Mass | 422.29 |
| IUPAC Name | methyl 7-[(1R,5S)-2-oxo-5-[(E,3R)-3-trimethylsilyloxyoct-1-enyl]cyclopent-3-en-1-yl]heptanoate |
| SMILES | CCCCC[C@H](/C=C/[C@H]1C=CC(=O)[C@@H]1CCCCCCC(=O)OC)O[Si](C)(C)C |
| InChI | InChI=1S/C24H42O4Si/c1-6-7-10-13-21(28-29(3,4)5)18-16-20-17-19-23(25)22(20)14-11-8-9-12-15-24(26)27-2/h16-22H,6-15H2,1-5H3/b18-16+/t20-,21+,22+/m0/s1 |
| InChIKey | LEEKIWQCOFKZII-LTLWPOLISA-N |
| XLogP | 6.23 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 422.68 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl 7-[(1R,5S)-2-oxo-5-[(E,3R)-3-trimethylsilyloxyoct-1-enyl]cyclopent-3-en-1-yl]heptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 7-[(1R,5S)-2-oxo-5-[(E,3R)-3-trimethylsilyloxyoct-1-enyl]cyclopent-3-en-1-yl]heptanoate?
The IUPAC name of methyl 7-[(1R,5S)-2-oxo-5-[(E,3R)-3-trimethylsilyloxyoct-1-enyl]cyclopent-3-en-1-yl]heptanoate (CID 6428805) is methyl 7-[(1R,5S)-2-oxo-5-[(E,3R)-3-trimethylsilyloxyoct-1-enyl]cyclopent-3-en-1-yl]heptanoate.
What is the SMILES notation for methyl 7-[(1R,5S)-2-oxo-5-[(E,3R)-3-trimethylsilyloxyoct-1-enyl]cyclopent-3-en-1-yl]heptanoate?
The canonical SMILES for methyl 7-[(1R,5S)-2-oxo-5-[(E,3R)-3-trimethylsilyloxyoct-1-enyl]cyclopent-3-en-1-yl]heptanoate is CCCCC[C@H](/C=C/[C@H]1C=CC(=O)[C@@H]1CCCCCCC(=O)OC)O[Si](C)(C)C.
What is the InChIKey of methyl 7-[(1R,5S)-2-oxo-5-[(E,3R)-3-trimethylsilyloxyoct-1-enyl]cyclopent-3-en-1-yl]heptanoate?
The InChIKey is LEEKIWQCOFKZII-LTLWPOLISA-N. The full InChI is InChI=1S/C24H42O4Si/c1-6-7-10-13-21(28-29(3,4)5)18-16-20-17-19-23(25)22(20)14-11-8-9-12-15-24(26)27-2/h16-22H,6-15H2,1-5H3/b18-16+/t20-,21+,22+/m0/s1.
What are the key properties of methyl 7-[(1R,5S)-2-oxo-5-[(E,3R)-3-trimethylsilyloxyoct-1-enyl]cyclopent-3-en-1-yl]heptanoate?
methyl 7-[(1R,5S)-2-oxo-5-[(E,3R)-3-trimethylsilyloxyoct-1-enyl]cyclopent-3-en-1-yl]heptanoate has a molecular weight of 422.68 g/mol, XLogP of 6.23, 15 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 7-[(1R,5S)-2-oxo-5-[(E,3R)-3-trimethylsilyloxyoct-1-enyl]cyclopent-3-en-1-yl]heptanoate is sourced from PubChem (CID 6428805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).