C14H10F10N2O2 — CID 6428826
N-(dimethylcarbamoyl)-2,2,3,3,4,4,4-heptafluoro-N-[4-(trifluoromethyl)phenyl]butanamide (PubChem CID 6428826) has the molecular formula C14H10F10N2O2 and a molecular weight of 428.23 g/mol. Its IUPAC name is N-(dimethylcarbamoyl)-2,2,3,3,4,4,4-heptafluoro-N-[4-(trifluoromethyl)phenyl]butanamide.
| Compound Name | N-(dimethylcarbamoyl)-2,2,3,3,4,4,4-heptafluoro-N-[4-(trifluoromethyl)phenyl]butanamide |
|---|---|
| PubChem CID | 6428826 |
| Molecular Formula | C14H10F10N2O2 |
| Molecular Weight | 428.23 g/mol |
| Exact Mass | 428.06 |
| IUPAC Name | N-(dimethylcarbamoyl)-2,2,3,3,4,4,4-heptafluoro-N-[4-(trifluoromethyl)phenyl]butanamide |
| SMILES | CN(C)C(=O)N(C(=O)C(F)(F)C(F)(F)C(F)(F)F)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H10F10N2O2/c1-25(2)10(28)26(8-5-3-7(4-6-8)12(17,18)19)9(27)11(15,16)13(20,21)14(22,23)24/h3-6H,1-2H3 |
| InChIKey | PNNDBKHPFIDXDY-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.23 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|