C26H46O2Si — CID 6428868
[tert-butyl(dimethyl)silyl] (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoate (PubChem CID 6428868) has the molecular formula C26H46O2Si and a molecular weight of 418.74 g/mol. Its IUPAC name is [tert-butyl(dimethyl)silyl] (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoate.
| Compound Name | [tert-butyl(dimethyl)silyl] (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoate |
|---|---|
| PubChem CID | 6428868 |
| Molecular Formula | C26H46O2Si |
| Molecular Weight | 418.74 g/mol |
| Exact Mass | 418.33 |
| IUPAC Name | [tert-butyl(dimethyl)silyl] (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoate |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H46O2Si/c1-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25(27)28-29(5,6)26(2,3)4/h11-12,14-15,17-18,20-21H,7-10,13,16,19,22-24H2,1-6H3/b12-11-,15-14-,18-17-,21-20- |
| InChIKey | YQNWZGLWMUXCMW-FORXSXPXSA-N |
| XLogP | 8.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.74 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|