About butyl 3-methylhexanoate
butyl 3-methylhexanoate (PubChem CID 6429068) has the molecular formula C11H22O2
and a molecular weight of 186.29 g/mol. Its IUPAC name is butyl 3-methylhexanoate.
Molecular Properties
| Compound Name | butyl 3-methylhexanoate |
| PubChem CID | 6429068 |
| Molecular Formula | C11H22O2 |
| Molecular Weight | 186.29 g/mol |
| Exact Mass | 186.16 |
| IUPAC Name | butyl 3-methylhexanoate |
| SMILES | CCCCOC(=O)CC(C)CCC |
| InChI | InChI=1S/C11H22O2/c1-4-6-8-13-11(12)9-10(3)7-5-2/h10H,4-9H2,1-3H3 |
| InChIKey | GTKBJPASOLCDLM-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.29 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl 3-methylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 3-methylhexanoate?
The IUPAC name of butyl 3-methylhexanoate (CID 6429068) is butyl 3-methylhexanoate.
What is the SMILES notation for butyl 3-methylhexanoate?
The canonical SMILES for butyl 3-methylhexanoate is CCCCOC(=O)CC(C)CCC.
What is the InChIKey of butyl 3-methylhexanoate?
The InChIKey is GTKBJPASOLCDLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O2/c1-4-6-8-13-11(12)9-10(3)7-5-2/h10H,4-9H2,1-3H3.
What are the key properties of butyl 3-methylhexanoate?
butyl 3-methylhexanoate has a molecular weight of 186.29 g/mol, XLogP of 3.16, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 3-methylhexanoate is sourced from PubChem (CID 6429068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).