About methyl (2S,5R)-3,7-dioxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate
methyl (2S,5R)-3,7-dioxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 642912) has the molecular formula C7H7NO4S
and a molecular weight of 201.20 g/mol. Its IUPAC name is methyl (2S,5R)-3,7-dioxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
Molecular Properties
| Compound Name | methyl (2S,5R)-3,7-dioxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| PubChem CID | 642912 |
| Molecular Formula | C7H7NO4S |
| Molecular Weight | 201.20 g/mol |
| Exact Mass | 201.01 |
| IUPAC Name | methyl (2S,5R)-3,7-dioxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | COC(=O)[C@H]1C(=O)S[C@@H]2CC(=O)N12 |
| InChI | InChI=1S/C7H7NO4S/c1-12-6(10)5-7(11)13-4-2-3(9)8(4)5/h4-5H,2H2,1H3/t4-,5+/m1/s1 |
| InChIKey | JEZHVOOXRBXXMJ-UHNVWZDZSA-N |
| XLogP | -0.64 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.20 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze methyl (2S,5R)-3,7-dioxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S,5R)-3,7-dioxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate?
The IUPAC name of methyl (2S,5R)-3,7-dioxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (CID 642912) is methyl (2S,5R)-3,7-dioxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
What is the SMILES notation for methyl (2S,5R)-3,7-dioxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate?
The canonical SMILES for methyl (2S,5R)-3,7-dioxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate is COC(=O)[C@H]1C(=O)S[C@@H]2CC(=O)N12.
What is the InChIKey of methyl (2S,5R)-3,7-dioxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate?
The InChIKey is JEZHVOOXRBXXMJ-UHNVWZDZSA-N. The full InChI is InChI=1S/C7H7NO4S/c1-12-6(10)5-7(11)13-4-2-3(9)8(4)5/h4-5H,2H2,1H3/t4-,5+/m1/s1.
What are the key properties of methyl (2S,5R)-3,7-dioxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate?
methyl (2S,5R)-3,7-dioxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate has a molecular weight of 201.20 g/mol, XLogP of -0.64, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S,5R)-3,7-dioxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate is sourced from PubChem (CID 642912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).