About (1S)-1,8-dimethyl-4-propan-2-ylspiro[4.5]deca-3,9-diene
(1S)-1,8-dimethyl-4-propan-2-ylspiro[4.5]deca-3,9-diene (PubChem CID 6429151) has the molecular formula C15H24
and a molecular weight of 204.36 g/mol. Its IUPAC name is (1S)-1,8-dimethyl-4-propan-2-ylspiro[4.5]deca-3,9-diene.
Molecular Properties
| Compound Name | (1S)-1,8-dimethyl-4-propan-2-ylspiro[4.5]deca-3,9-diene |
| PubChem CID | 6429151 |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.36 g/mol |
| Exact Mass | 204.19 |
| IUPAC Name | (1S)-1,8-dimethyl-4-propan-2-ylspiro[4.5]deca-3,9-diene |
| SMILES | CC1C=CC2(CC1)C(C(C)C)=CC[C@@H]2C |
| InChI | InChI=1S/C15H24/c1-11(2)14-6-5-13(4)15(14)9-7-12(3)8-10-15/h6-7,9,11-13H,5,8,10H2,1-4H3/t12?,13-,15?/m0/s1 |
| InChIKey | XTISJFXWBIASHF-OWYJLGKBSA-N |
| XLogP | 4.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.36 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1S)-1,8-dimethyl-4-propan-2-ylspiro[4.5]deca-3,9-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1,8-dimethyl-4-propan-2-ylspiro[4.5]deca-3,9-diene?
The IUPAC name of (1S)-1,8-dimethyl-4-propan-2-ylspiro[4.5]deca-3,9-diene (CID 6429151) is (1S)-1,8-dimethyl-4-propan-2-ylspiro[4.5]deca-3,9-diene.
What is the SMILES notation for (1S)-1,8-dimethyl-4-propan-2-ylspiro[4.5]deca-3,9-diene?
The canonical SMILES for (1S)-1,8-dimethyl-4-propan-2-ylspiro[4.5]deca-3,9-diene is CC1C=CC2(CC1)C(C(C)C)=CC[C@@H]2C.
What is the InChIKey of (1S)-1,8-dimethyl-4-propan-2-ylspiro[4.5]deca-3,9-diene?
The InChIKey is XTISJFXWBIASHF-OWYJLGKBSA-N. The full InChI is InChI=1S/C15H24/c1-11(2)14-6-5-13(4)15(14)9-7-12(3)8-10-15/h6-7,9,11-13H,5,8,10H2,1-4H3/t12?,13-,15?/m0/s1.
What are the key properties of (1S)-1,8-dimethyl-4-propan-2-ylspiro[4.5]deca-3,9-diene?
(1S)-1,8-dimethyl-4-propan-2-ylspiro[4.5]deca-3,9-diene has a molecular weight of 204.36 g/mol, XLogP of 4.58, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1,8-dimethyl-4-propan-2-ylspiro[4.5]deca-3,9-diene is sourced from PubChem (CID 6429151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).