About 2-ethenyl-2-methyl-9-methylidene-7-(2-methylprop-1-enyl)-1,6-dioxaspiro[4.4]nonane
2-ethenyl-2-methyl-9-methylidene-7-(2-methylprop-1-enyl)-1,6-dioxaspiro[4.4]nonane (PubChem CID 6429155) has the molecular formula C15H22O2
and a molecular weight of 234.34 g/mol. Its IUPAC name is 2-ethenyl-2-methyl-9-methylidene-7-(2-methylprop-1-enyl)-1,6-dioxaspiro[4.4]nonane.
Molecular Properties
| Compound Name | 2-ethenyl-2-methyl-9-methylidene-7-(2-methylprop-1-enyl)-1,6-dioxaspiro[4.4]nonane |
| PubChem CID | 6429155 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | 2-ethenyl-2-methyl-9-methylidene-7-(2-methylprop-1-enyl)-1,6-dioxaspiro[4.4]nonane |
| SMILES | C=CC1(C)CCC2(OC(C=C(C)C)CC2=C)O1 |
| InChI | InChI=1S/C15H22O2/c1-6-14(5)7-8-15(17-14)12(4)10-13(16-15)9-11(2)3/h6,9,13H,1,4,7-8,10H2,2-3,5H3 |
| InChIKey | WKVFNUBTMXSGNM-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-ethenyl-2-methyl-9-methylidene-7-(2-methylprop-1-enyl)-1,6-dioxaspiro[4.4]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenyl-2-methyl-9-methylidene-7-(2-methylprop-1-enyl)-1,6-dioxaspiro[4.4]nonane?
The IUPAC name of 2-ethenyl-2-methyl-9-methylidene-7-(2-methylprop-1-enyl)-1,6-dioxaspiro[4.4]nonane (CID 6429155) is 2-ethenyl-2-methyl-9-methylidene-7-(2-methylprop-1-enyl)-1,6-dioxaspiro[4.4]nonane.
What is the SMILES notation for 2-ethenyl-2-methyl-9-methylidene-7-(2-methylprop-1-enyl)-1,6-dioxaspiro[4.4]nonane?
The canonical SMILES for 2-ethenyl-2-methyl-9-methylidene-7-(2-methylprop-1-enyl)-1,6-dioxaspiro[4.4]nonane is C=CC1(C)CCC2(OC(C=C(C)C)CC2=C)O1.
What is the InChIKey of 2-ethenyl-2-methyl-9-methylidene-7-(2-methylprop-1-enyl)-1,6-dioxaspiro[4.4]nonane?
The InChIKey is WKVFNUBTMXSGNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22O2/c1-6-14(5)7-8-15(17-14)12(4)10-13(16-15)9-11(2)3/h6,9,13H,1,4,7-8,10H2,2-3,5H3.
What are the key properties of 2-ethenyl-2-methyl-9-methylidene-7-(2-methylprop-1-enyl)-1,6-dioxaspiro[4.4]nonane?
2-ethenyl-2-methyl-9-methylidene-7-(2-methylprop-1-enyl)-1,6-dioxaspiro[4.4]nonane has a molecular weight of 234.34 g/mol, XLogP of 3.75, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenyl-2-methyl-9-methylidene-7-(2-methylprop-1-enyl)-1,6-dioxaspiro[4.4]nonane is sourced from PubChem (CID 6429155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).