About [(3S,5S)-2,2-dimethyl-5-prop-1-en-2-yloxolan-3-yl]methyl acetate
[(3S,5S)-2,2-dimethyl-5-prop-1-en-2-yloxolan-3-yl]methyl acetate (PubChem CID 6429170) has the molecular formula C12H20O3
and a molecular weight of 212.29 g/mol. Its IUPAC name is [(3S,5S)-2,2-dimethyl-5-prop-1-en-2-yloxolan-3-yl]methyl acetate.
Molecular Properties
| Compound Name | [(3S,5S)-2,2-dimethyl-5-prop-1-en-2-yloxolan-3-yl]methyl acetate |
| PubChem CID | 6429170 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | [(3S,5S)-2,2-dimethyl-5-prop-1-en-2-yloxolan-3-yl]methyl acetate |
| SMILES | C=C(C)[C@@H]1C[C@@H](COC(C)=O)C(C)(C)O1 |
| InChI | InChI=1S/C12H20O3/c1-8(2)11-6-10(7-14-9(3)13)12(4,5)15-11/h10-11H,1,6-7H2,2-5H3/t10-,11-/m0/s1 |
| InChIKey | ZIYIQFWIKYQOLB-QWRGUYRKSA-N |
| XLogP | 2.31 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(3S,5S)-2,2-dimethyl-5-prop-1-en-2-yloxolan-3-yl]methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S,5S)-2,2-dimethyl-5-prop-1-en-2-yloxolan-3-yl]methyl acetate?
The IUPAC name of [(3S,5S)-2,2-dimethyl-5-prop-1-en-2-yloxolan-3-yl]methyl acetate (CID 6429170) is [(3S,5S)-2,2-dimethyl-5-prop-1-en-2-yloxolan-3-yl]methyl acetate.
What is the SMILES notation for [(3S,5S)-2,2-dimethyl-5-prop-1-en-2-yloxolan-3-yl]methyl acetate?
The canonical SMILES for [(3S,5S)-2,2-dimethyl-5-prop-1-en-2-yloxolan-3-yl]methyl acetate is C=C(C)[C@@H]1C[C@@H](COC(C)=O)C(C)(C)O1.
What is the InChIKey of [(3S,5S)-2,2-dimethyl-5-prop-1-en-2-yloxolan-3-yl]methyl acetate?
The InChIKey is ZIYIQFWIKYQOLB-QWRGUYRKSA-N. The full InChI is InChI=1S/C12H20O3/c1-8(2)11-6-10(7-14-9(3)13)12(4,5)15-11/h10-11H,1,6-7H2,2-5H3/t10-,11-/m0/s1.
What are the key properties of [(3S,5S)-2,2-dimethyl-5-prop-1-en-2-yloxolan-3-yl]methyl acetate?
[(3S,5S)-2,2-dimethyl-5-prop-1-en-2-yloxolan-3-yl]methyl acetate has a molecular weight of 212.29 g/mol, XLogP of 2.31, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S,5S)-2,2-dimethyl-5-prop-1-en-2-yloxolan-3-yl]methyl acetate is sourced from PubChem (CID 6429170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).