C15H24 — CID 6429215
4,4,7,8a-tetramethyl-8-methylidene-2,3,4a,5-tetrahydro-1H-naphthalene (PubChem CID 6429215) has the molecular formula C15H24 and a molecular weight of 204.36 g/mol. Its IUPAC name is 4,4,7,8a-tetramethyl-8-methylidene-2,3,4a,5-tetrahydro-1H-naphthalene.
| Compound Name | 4,4,7,8a-tetramethyl-8-methylidene-2,3,4a,5-tetrahydro-1H-naphthalene |
|---|---|
| PubChem CID | 6429215 |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.36 g/mol |
| Exact Mass | 204.19 |
| IUPAC Name | 4,4,7,8a-tetramethyl-8-methylidene-2,3,4a,5-tetrahydro-1H-naphthalene |
| SMILES | C=C1C(C)=CCC2C(C)(C)CCCC12C |
| InChI | InChI=1S/C15H24/c1-11-7-8-13-14(3,4)9-6-10-15(13,5)12(11)2/h7,13H,2,6,8-10H2,1,3-5H3 |
| InChIKey | IQLMHLRIRXSXLQ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.36 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |